cas: 20372-63-8 — see every product listed under this CAS number, including other names
4,5-Difluoro-2-nitrobenzoic Acid, >98.0%(GC)(T) (CAS 20372-63-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | D3555-5G |
| cas | 20372-63-8 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 206.86 Pln | |
| TCI | 25g | 614.99 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC)(T) |
4,5-difluoro-2-nitrobenzoic acid (CAS 20372-63-8) is a chemical compound with the molecular formula C7H3F2NO4 and a molecular weight of 203.10 g/mol. IUPAC name: 4,5-difluoro-2-nitrobenzoic acid. InChIKey: HGGRAOYTQNFGGN-UHFFFAOYSA-N.
| Molecular formula | C7H3F2NO4 |
|---|---|
| Molecular weight | 203.10 g/mol |
| IUPAC name | 4,5-difluoro-2-nitrobenzoic acid |
| InChIKey | HGGRAOYTQNFGGN-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)F)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)