cas: 773869-46-8 — see every product listed under this CAS number, including other names
5-Chloro-2,3-difluoro-4-methylbenzoic acid, 95%, 95% (CAS 773869-46-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11G6BX-100mg |
| cas | 773869-46-8 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 750.80 Pln | |
| Chemat | 250mg | 1370.00 Pln | |
| Chemat | 1g | 2680.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
5-chloro-2,3-difluoro-4-methylbenzoic acid (CAS 773869-46-8) is a chemical compound with the molecular formula C8H5ClF2O2 and a molecular weight of 206.57 g/mol. IUPAC name: 5-chloro-2,3-difluoro-4-methylbenzoic acid. InChIKey: XNUGHWYSXYFWKR-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF2O2 |
|---|---|
| Molecular weight | 206.57 g/mol |
| IUPAC name | 5-chloro-2,3-difluoro-4-methylbenzoic acid |
| InChIKey | XNUGHWYSXYFWKR-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C(=C1F)F)C(=O)O)Cl |
Computed by PubChem (NCBI)