cas: 773869-46-8 — see every product listed under this CAS number, including other names
5-Chloro-2,3-difluoro-4-methylbenzoic acid (CAS 773869-46-8) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F334671-1G |
| cas | 773869-46-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 4006.94 Pln |
| delivery time | 3-4 weeks |
|---|
5-chloro-2,3-difluoro-4-methylbenzoic acid (CAS 773869-46-8) is a chemical compound with the molecular formula C8H5ClF2O2 and a molecular weight of 206.57 g/mol. IUPAC name: 5-chloro-2,3-difluoro-4-methylbenzoic acid. InChIKey: XNUGHWYSXYFWKR-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF2O2 |
|---|---|
| Molecular weight | 206.57 g/mol |
| IUPAC name | 5-chloro-2,3-difluoro-4-methylbenzoic acid |
| InChIKey | XNUGHWYSXYFWKR-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C(=C1F)F)C(=O)O)Cl |
Computed by PubChem (NCBI)