cas: 1706446-43-6 — see every product listed under this CAS number, including other names
6-Chloro-2,4-difluoro-3-methylbenzoic acid, 95%, 95% (CAS 1706446-43-6) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FGP6-50mg |
| cas | 1706446-43-6 |
| size | 50mg |
| availability | 0.2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 3371.60 Pln | |
| Chemat | 100mg | 5378.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
6-chloro-2,4-difluoro-3-methylbenzoic acid (CAS 1706446-43-6) is a chemical compound with the molecular formula C8H5ClF2O2 and a molecular weight of 206.57 g/mol. IUPAC name: 6-chloro-2,4-difluoro-3-methylbenzoic acid. InChIKey: GOWZQYJWODLKSX-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF2O2 |
|---|---|
| Molecular weight | 206.57 g/mol |
| IUPAC name | 6-chloro-2,4-difluoro-3-methylbenzoic acid |
| InChIKey | GOWZQYJWODLKSX-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1F)Cl)C(=O)O)F |
Computed by PubChem (NCBI)