CAS 1261562-52-0 is the registry number for Methyl 2-chloro-3,4-difluorobenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Methyl 2-chloro-3,4-difluorobenzoate (CAS 1261562-52-0) is a chemical compound with the molecular formula C8H5ClF2O2 and a molecular weight of 206.57 g/mol. IUPAC name: methyl 2-chloro-3,4-difluorobenzoate. InChIKey: OIEYNXFWROGHMB-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF2O2 |
|---|---|
| Molecular weight | 206.57 g/mol |
| IUPAC name | methyl 2-chloro-3,4-difluorobenzoate |
| InChIKey | OIEYNXFWROGHMB-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=C(C=C1)F)F)Cl |
Computed by PubChem (NCBI)