CAS 1261632-58-9 appears in our catalog under these names: 5-Chloro-2,4-difluorophenylacetic acid, 95%, 5-Chloro-2,4-difluorophenylacetic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 5g, 2,5g.
2-(5-chloro-2,4-difluorophenyl)acetic acid (CAS 1261632-58-9) is a chemical compound with the molecular formula C8H5ClF2O2 and a molecular weight of 206.57 g/mol. IUPAC name: 2-(5-chloro-2,4-difluorophenyl)acetic acid. InChIKey: LJMKSRVRPKJUFS-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF2O2 |
|---|---|
| Molecular weight | 206.57 g/mol |
| IUPAC name | 2-(5-chloro-2,4-difluorophenyl)acetic acid |
| InChIKey | LJMKSRVRPKJUFS-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Cl)F)F)CC(=O)O |
Computed by PubChem (NCBI)