Products 1261846-02-9
CAS 1261846-02-9 appears in our catalog under these names: Methyl 2-chloro-3,5-difluorobenzoate, 95%, Methyl 2-chloro-3,5-difluorobenzoate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
Methyl 2-chloro-3,5-difluorobenzoate (CAS 1261846-02-9) is a chemical compound with the molecular formula C8H5ClF2O2 and a molecular weight of 206.57 g/mol. IUPAC name: methyl 2-chloro-3,5-difluorobenzoate. InChIKey: IYDYFGQDDRCRGF-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF2O2 |
|---|---|
| Molecular weight | 206.57 g/mol |
| IUPAC name | methyl 2-chloro-3,5-difluorobenzoate |
| InChIKey | IYDYFGQDDRCRGF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CC(=C1)F)F)Cl |
Computed by PubChem (NCBI)