CAS 1435806-39-5 appears in our catalog under these names: 4-(Chloromethyl)-2,2-difluoro-1,3-benzodioxole, 98%, 4-(Chloromethyl)-2,2-difluorobenzo(d)(1,3)dioxole, 98%, 4-(Chloromethyl)-2,2-difluoro-1,3-dioxaindane. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 250mg, 10g, 5g, 2,5g.
4-(chloromethyl)-2,2-difluoro-1,3-benzodioxole (CAS 1435806-39-5) is a chemical compound with the molecular formula C8H5ClF2O2 and a molecular weight of 206.57 g/mol. IUPAC name: 4-(chloromethyl)-2,2-difluoro-1,3-benzodioxole. InChIKey: ZASZKFQADMACSA-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF2O2 |
|---|---|
| Molecular weight | 206.57 g/mol |
| IUPAC name | 4-(chloromethyl)-2,2-difluoro-1,3-benzodioxole |
| InChIKey | ZASZKFQADMACSA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1)OC(O2)(F)F)CCl |
Computed by PubChem (NCBI)