CAS 1556403-83-8 appears in our catalog under these names: 2-Chloro-4-(difluoromethyl)benzoic acid, 95%, 2-Chloro-4-(difluoromethyl)benzoic acid, 2-CHLORO-4-(DIFLUOROMETHYL)BENZOIC ACID, 95%, 95%, 2-Chloro-4-(difluoromethyl)benzoic acid, 98%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 0,5g, 50mg, 100mg, 250mg.
2-chloro-4-(difluoromethyl)benzoic acid (CAS 1556403-83-8) is a chemical compound with the molecular formula C8H5ClF2O2 and a molecular weight of 206.57 g/mol. IUPAC name: 2-chloro-4-(difluoromethyl)benzoic acid. InChIKey: RLVUDKTVDCDWFX-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF2O2 |
|---|---|
| Molecular weight | 206.57 g/mol |
| IUPAC name | 2-chloro-4-(difluoromethyl)benzoic acid |
| InChIKey | RLVUDKTVDCDWFX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)F)Cl)C(=O)O |
Computed by PubChem (NCBI)