CAS 2222162-05-0 appears in our catalog under these names: 4-Chloro-3-(difluoromethyl)benzoic acid, 95%, 4-Chloro-3-(difluoromethyl)benzoic acid, 97%, 97%, 4-CHLORO-3-(DIFLUOROMETHYL)BENZOIC ACID, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
4-chloro-3-(difluoromethyl)benzoic acid (CAS 2222162-05-0) is a chemical compound with the molecular formula C8H5ClF2O2 and a molecular weight of 206.57 g/mol. IUPAC name: 4-chloro-3-(difluoromethyl)benzoic acid. InChIKey: ZINKQBYMKNDPJB-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF2O2 |
|---|---|
| Molecular weight | 206.57 g/mol |
| IUPAC name | 4-chloro-3-(difluoromethyl)benzoic acid |
| InChIKey | ZINKQBYMKNDPJB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)C(F)F)Cl |
Computed by PubChem (NCBI)