Products 2228822-20-4
CAS 2228822-20-4 is the registry number for 1-(2-Chloro-4-hydroxyphenyl)-2,2-difluoroethan-1-one, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
1-(2-chloro-4-hydroxyphenyl)-2,2-difluoroethanone (CAS 2228822-20-4) is a chemical compound with the molecular formula C8H5ClF2O2 and a molecular weight of 206.57 g/mol. IUPAC name: 1-(2-chloro-4-hydroxyphenyl)-2,2-difluoroethanone. InChIKey: XQVBOGSURGKJQU-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF2O2 |
|---|---|
| Molecular weight | 206.57 g/mol |
| IUPAC name | 1-(2-chloro-4-hydroxyphenyl)-2,2-difluoroethanone |
| InChIKey | XQVBOGSURGKJQU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1O)Cl)C(=O)C(F)F |
Computed by PubChem (NCBI)