CAS 261762-53-2 appears in our catalog under these names: 2-(3-Chloro-2,6-difluorophenyl)acetic acid, 95+%, 3-Chloro-2,6-difluorophenylacetic acid, 95%. Offered by: AmBeed, Combi-blocks, Fluorochem. Available pack sizes: 10g, 1g, 250mg, 500mg.
2-(3-chloro-2,6-difluorophenyl)acetic acid (CAS 261762-53-2) is a chemical compound with the molecular formula C8H5ClF2O2 and a molecular weight of 206.57 g/mol. IUPAC name: 2-(3-chloro-2,6-difluorophenyl)acetic acid. InChIKey: KYNHMNUEUZZTLW-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF2O2 |
|---|---|
| Molecular weight | 206.57 g/mol |
| IUPAC name | 2-(3-chloro-2,6-difluorophenyl)acetic acid |
| InChIKey | KYNHMNUEUZZTLW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1F)CC(=O)O)F)Cl |
Computed by PubChem (NCBI)