Products 2919947-02-5
CAS 2919947-02-5 is the registry number for 3-(Chlorodifluoromethyl)benzoic acid, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
3-[chloro(difluoro)methyl]benzoic acid (CAS 2919947-02-5) is a chemical compound with the molecular formula C8H5ClF2O2 and a molecular weight of 206.57 g/mol. IUPAC name: 3-[chloro(difluoro)methyl]benzoic acid. InChIKey: XZTJDKXKFGNLSJ-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF2O2 |
|---|---|
| Molecular weight | 206.57 g/mol |
| IUPAC name | 3-[chloro(difluoro)methyl]benzoic acid |
| InChIKey | XZTJDKXKFGNLSJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)Cl)C(=O)O |
Computed by PubChem (NCBI)