Products 475301-73-6
CAS 475301-73-6 appears in our catalog under these names: 2–(4–chlorophenyl)–2，2–difluoroacetic acid, 2-(4-Chlorophenyl)-2,2-difluoroacetic acid, 2-(4-Chlorophenyl)-2,2-difluoroacetic acid 98%, 2-(4-Chlorophenyl)-2,2-difluoroacetic acid, 98%, 98%, 2,2-Difluoro-2-(4-chlorophenyl)acetic acid, 97%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 25g, 10g, 100mg, 2.5g.
2-(4-chlorophenyl)-2,2-difluoroacetic acid (CAS 475301-73-6) is a chemical compound with the molecular formula C8H5ClF2O2 and a molecular weight of 206.57 g/mol. IUPAC name: 2-(4-chlorophenyl)-2,2-difluoroacetic acid. InChIKey: DZXMMDCITYLSRC-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF2O2 |
|---|---|
| Molecular weight | 206.57 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-2,2-difluoroacetic acid |
| InChIKey | DZXMMDCITYLSRC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C(=O)O)(F)F)Cl |
Computed by PubChem (NCBI)
Synonyms:
2-(4-chlorophenyl)-2,2-difluoroacetic acid, (4-chlorophenyl)(difluoro)acetic acid, 2-(4-Chlorophenyl)-2,2-difluoroaceticacid, 2,2-Difluoro-2-(4-chlorophenyl)acetic acid, 2,2-Difluoro-2-(4, 2-(4-chlorophenyl)-2,2-difluoro-acetic Acid, orb3029654, Fr213033, (4-Chlorophenyl)di(fluoro)acetic acid