Products 773874-02-5
CAS 773874-02-5 appears in our catalog under these names: Methyl 2-chloro-3,6-difluorobenzoate, 95%, Methyl 2-chloro-3,6-difluorobenzoate, 98%, Methyl 2-chloro-3,6-difluorobenzoate, ≥95%, ≥95%, Methyl 2-chloro-3,6-difluorobenzoate. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
Methyl 2-chloro-3,6-difluorobenzoate (CAS 773874-02-5) is a chemical compound with the molecular formula C8H5ClF2O2 and a molecular weight of 206.57 g/mol. IUPAC name: methyl 2-chloro-3,6-difluorobenzoate. InChIKey: MUZXEGBDPWQNJE-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF2O2 |
|---|---|
| Molecular weight | 206.57 g/mol |
| IUPAC name | methyl 2-chloro-3,6-difluorobenzoate |
| InChIKey | MUZXEGBDPWQNJE-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1Cl)F)F |
Computed by PubChem (NCBI)