Products 887585-13-9
CAS 887585-13-9 appears in our catalog under these names: 6-Chloro-2,3-difluorophenylacetic acid, 95%, 2-(6-Chloro-2,3-difluorophenyl)acetic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
2-(6-chloro-2,3-difluorophenyl)acetic acid (CAS 887585-13-9) is a chemical compound with the molecular formula C8H5ClF2O2 and a molecular weight of 206.57 g/mol. IUPAC name: 2-(6-chloro-2,3-difluorophenyl)acetic acid. InChIKey: RPTVDWIUTLULDO-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF2O2 |
|---|---|
| Molecular weight | 206.57 g/mol |
| IUPAC name | 2-(6-chloro-2,3-difluorophenyl)acetic acid |
| InChIKey | RPTVDWIUTLULDO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1F)F)CC(=O)O)Cl |
Computed by PubChem (NCBI)