cas: 20372-63-8 — see every product listed under this CAS number, including other names
4,5-Difluoro-2-nitrobenzoic acid, 97%, 97% (CAS 20372-63-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114KHY-1g |
| cas | 20372-63-8 |
| size | 1g |
| availability | 5500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 98.00 Pln | |
| Chemat | 25g | 141.20 Pln | |
| Chemat | 100g | 381.20 Pln | |
| Chemat | 500g | 1435.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4,5-difluoro-2-nitrobenzoic acid (CAS 20372-63-8) is a chemical compound with the molecular formula C7H3F2NO4 and a molecular weight of 203.10 g/mol. IUPAC name: 4,5-difluoro-2-nitrobenzoic acid. InChIKey: HGGRAOYTQNFGGN-UHFFFAOYSA-N.
| Molecular formula | C7H3F2NO4 |
|---|---|
| Molecular weight | 203.10 g/mol |
| IUPAC name | 4,5-difluoro-2-nitrobenzoic acid |
| InChIKey | HGGRAOYTQNFGGN-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)F)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)