4,5-Difluoro-2-nitrobenzoic acid 97%
cas: 20372-63-8 — see every product listed under this CAS number, including other names
4,5-Difluoro-2-nitrobenzoic acid 97% (CAS 20372-63-8) is a chemical reagent available from Chemat. Available pack sizes: 1000g, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A623826-1000g |
| cas | 20372-63-8 |
| size | 1000g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1000g | 2367.31 Pln | |
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 10g | 147.88 Pln | |
| Ambeed | 25g | 164.56 Pln | |
| Ambeed | 100g | 325.88 Pln | |
| Ambeed | 500g | 1299.31 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A623826 |
4,5-difluoro-2-nitrobenzoic acid (CAS 20372-63-8) is a chemical compound with the molecular formula C7H3F2NO4 and a molecular weight of 203.10 g/mol. IUPAC name: 4,5-difluoro-2-nitrobenzoic acid. InChIKey: HGGRAOYTQNFGGN-UHFFFAOYSA-N.
| Molecular formula | C7H3F2NO4 |
|---|---|
| Molecular weight | 203.10 g/mol |
| IUPAC name | 4,5-difluoro-2-nitrobenzoic acid |
| InChIKey | HGGRAOYTQNFGGN-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)F)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)